Product
High Quality Chinese Manufacturer supply 14121-55-2 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid We provide high quality 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid (CAS 14121-55-2), at a very affordable prices to our customers.
1.What is the 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid ?
1,2,3,4-Tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid, commonly known as TDQC, is a chemical compound with the formula C10H7NO5. It belongs to the quinoxaline family, which is recognized for its pharmacological properties. As a dioxoquinoxaline derivative, TDQC contains two carbonyl groups (-C(=O)-) and one carboxylic acid group (-COOH), indicating its potential reactivity in various chemical reactions. However, its specific properties, applications, and effects are not well-documented, and it is primarily used for research purposes. Due to the limited information on its safety and toxicity, TDQC must be handled with care and precision.
Used in Pharmaceutical Research:
1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is used as a research compound for exploring its potential pharmacological properties and applications in the pharmaceutical industry. Its presence in the quinoxaline family suggests that it may have therapeutic potential, but further research is needed to understand its specific effects and safety profile.
Used in Chemical Reactions:
1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is used as a reactive compound in various chemical reactions due to its carbonyl and carboxylic acid groups. These functional groups can participate in a range of reactions, making TDQC a valuable intermediate in the synthesis of other compounds.
Used in Material Science:
1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is used as a building block in the development of new materials, particularly in the field of organic electronics. Its unique structure and reactivity may contribute to the creation of novel materials with specific properties, such as conductivity or stability.
Used in Analytical Chemistry:
1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is used as a reference compound or analytical standard in various analytical techniques, such as chromatography or spectroscopy. Its distinct chemical properties can help in the identification and quantification of other compounds in complex mixtures.
2.What is the CAS number for 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid ?
The CAS number of 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is 14121-55-2.
More information of 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid 14121-55-2 are:
|
CAS?Number |
14121-55-2 |
|
Density |
1.54g/cm3 |
|
Boiling Point |
593°Cat760mmHg |
|
Flash Point |
312.4°C |
|
Vapor Pressure |
6.59E-15mmHg at 25°C |
|
Refractive Index |
1.631 |
|
HS CODE |
2933990090 |
|
PSA |
103.02000 |
|
LogP |
-0.08540 |
3.What is the molecular formula of 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid ?
The chemical formula of?1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is C9H6 N2 O4 which containing 9 Carbon atoms,6 Hydrogen atoms,2 Nitrogen atoms and 4 Oxygen atoms,and the molecular weight, and the molecular weight of 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid is 206.158
4.What is 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid(14121-55-2)used for?
1,2,3,4-Tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid, commonly known as TDQC, is a chemical compound with the formula C10H7NO5. It belongs to the quinoxaline family, which is recognized for its pharmacological properties. As a dioxoquinoxaline derivative, TDQC contains two carbonyl groups (-C(=O)-) and one carboxylic acid group (-COOH), indicating its potential reactivity in various chemical reactions. However, its specific properties, applications, and effects are not well-documented, and it is primarily used for research purposes. Due to the limited information on its safety and toxicity, TDQC must be handled with care and precision.
InChI:InChI=1/C9H6N2O4/c12-7-8(13)11-6-3-4(9(14)15)1-2-5(6)10-7/h1-3H,(H,10,12)(H,11,13)(H,14,15)
Relevant articles related to 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid:
|
Article |
Source |
|
Choline Chloride-based Eutectic Mixtures for Greener Synthesis of Quinoxaline-2,3-diol Derivatives and Terephthalaldehyde bis-(2-Aminophenylimine) |
Aghapoor, Kioumars,Darabi, Hossein Reza,Mohsenzadeh, Farshid,Sayahi, Hani , (2021/12/29) |
5.High Quality Chinese Manufacturer supply 14121-55-2 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid
Jinhe Chemical Co., Ltd. is a quality supplier of 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 1,2,3,4-tetrahydro-2,3-dioxoquinoxaline-6-carboxylic acid 14121-55-2.