Cost-effective and customizable alpha-Aminocaproic acid 327-57-1 supplier We provide high quality alpha-Aminocaproic acid (CAS 327-57-1), at a very affordable prices to our customers.
1.What is the alpha-Aminocaproic acid ?
Alpha-Aminocaproic acid, also known as ε-aminocaproic acid or ACA, is a non-essential amino acid that plays a crucial role in various biological processes. It is a naturally occurring compound found in various foods and is also synthesized in the human body. Its molecular structure consists of a central carbon atom bonded to an amino group, a carboxyl group, and two methyl groups. Due to its unique properties, alpha-aminocaproic acid has found applications in various industries, including pharmaceutical, medical, and analytical chemistry.
A non-essential amino acid. Used as internal standard in amino acid analysis.
2.What is the CAS number for alpha-Aminocaproic acid ?
The CAS number of alpha-Aminocaproic acid is 327-57-1.
More information of alpha-Aminocaproic acid 327-57-1 are:
|
CAS?Number |
327-57-1 |
|
Density |
1.038 g/cm3 |
|
Melting Point |
>300 °C(lit.) |
|
Boiling Point |
234 °C at 760 mmHg |
|
Flash Point |
95.3 °C |
|
Vapor Pressure |
0.0188mmHg at 25°C |
|
Refractive Index |
23 ° (C=5, 5mol/L HCl) |
|
HS CODE |
29224995 |
|
PSA |
63.32000 |
|
LogP |
1.28880 |
|
Pka |
2.335(at 25℃) |
3.What is the molecular formula of alpha-Aminocaproic acid ?
The chemical formula of?alpha-Aminocaproic acid is C6H13NO2 which containing 6 Carbon atoms,13 Hydrogen atoms,1 Nitrogen atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of alpha-Aminocaproic acid is 131.175
4.What is alpha-Aminocaproic acid(327-57-1)used for?
Alpha-Aminocaproic acid, also known as ε-aminocaproic acid or ACA, is a non-essential amino acid that plays a crucial role in various biological processes. It is a naturally occurring compound found in various foods and is also synthesized in the human body. Its molecular structure consists of a central carbon atom bonded to an amino group, a carboxyl group, and two methyl groups. Due to its unique properties, alpha-aminocaproic acid has found applications in various industries, including pharmaceutical, medical, and analytical chemistry.
InChI:InChI=1/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1
Relevant articles related to alpha-Aminocaproic acid:
|
Article |
Source |
|
Enantioselective biocatalytic formal α-amination of hexanoic acid to l-norleucine |
Dennig, Alexander,Gandomkar, Somayyeh,Cigan, Emmanuel,Reiter, Tamara C.,Haas, Thomas,Hall, Mélanie,Faber, Kurt , p. 8030 - 8033 (2018) |
|
Semi-rational hinge engineering: modulating the conformational transformation of glutamate dehydrogenase for enhanced reductive amination activity towards non-natural substrates |
Liu, Yayun,Meng, Lijun,Wu, Jianping,Yang, Lirong,Yin, Xinjian,Zhou, Haisheng , p. 3376 - 3386 (2020/06/09) |
5.Cost-effective and customizable alpha-Aminocaproic acid 327-57-1 supplier
Jinhe Chemical Co., Ltd. is a quality supplier of alpha-Aminocaproic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on alpha-Aminocaproic acid 327-57-1.