What is the 3-PYRIDYLTHIOUREA?

3-PYRIDYLTHIOUREA is solid, while it's Molecular Formula is C6H7N3S. solid Used in Pharmaceutical Industry: 3-Pyridylthiourea is used as a pharmaceutical agent for its antifungal and antibacterial properties, making it a potential candidate for the treatment of various diseases caused by microbial infections. Used in Medicinal Chemistry: In the realm of medicinal chemistry, 3-Pyridylthiourea is utilized as a precursor in the synthesis of new compounds with potential therapeutic applications, leveraging its unique reactivity to create novel pharmaceuticals. Used in Organic Synthesis: 3-Pyridylthiourea is used as a reagent in organic synthesis, contributing to the creation of a variety of organic compounds due to its ability to participate in multiple chemical reactions.

What is the CAS number for 3-PYRIDYLTHIOUREA?

The CAS number of 3-PYRIDYLTHIOUREA is 30162-37-9.

What is 3-PYRIDYLTHIOUREA (30162-37-9) used for?

3-Pyridylthiourea, with the molecular formula C7H8N2S, is a white crystalline solid that exhibits solubility in both water and organic solvents. This chemical compound is recognized for its diverse biological activities, such as antifungal and antibacterial properties, which have garnered interest in the fields of pharmacology and medicinal chemistry for the treatment of a range of diseases. Furthermore, 3-pyridylthiourea's unique reactivity and capacity to engage in various chemical reactions make it a valuable component in the synthesis of other organic compounds.InChI:InChI=1/C6H7N3S/c7-6(10)9-5-2-1-3-8-4-5/h1-4H,(H3,7,9,10)

What is the 3-PYRIDYLTHIOUREA?

3-PYRIDYLTHIOUREA is solid, while it's Molecular Formula is C6H7N3S. solid Used in Pharmaceutical Industry: 3-Pyridylthiourea is used as a pharmaceutical agent for its antifungal and antibacterial properties, making it a potential candidate for the treatment of various diseases caused by microbial infections. Used in Medicinal Chemistry: In the realm of medicinal chemistry, 3-Pyridylthiourea is utilized as a precursor in the synthesis of new compounds with potential therapeutic applications, leveraging its unique reactivity to create novel pharmaceuticals. Used in Organic Synthesis: 3-Pyridylthiourea is used as a reagent in organic synthesis, contributing to the creation of a variety of organic compounds due to its ability to participate in multiple chemical reactions.

What is the CAS number for 3-PYRIDYLTHIOUREA?

The CAS number of 3-PYRIDYLTHIOUREA is 30162-37-9.

What is 3-PYRIDYLTHIOUREA (30162-37-9) used for?

3-Pyridylthiourea, with the molecular formula C7H8N2S, is a white crystalline solid that exhibits solubility in both water and organic solvents. This chemical compound is recognized for its diverse biological activities, such as antifungal and antibacterial properties, which have garnered interest in the fields of pharmacology and medicinal chemistry for the treatment of a range of diseases. Furthermore, 3-pyridylthiourea's unique reactivity and capacity to engage in various chemical reactions make it a valuable component in the synthesis of other organic compounds.InChI:InChI=1/C6H7N3S/c7-6(10)9-5-2-1-3-8-4-5/h1-4H,(H3,7,9,10)